What is the PubChem CID of 5-Chloro-2-fluorophenol?
PubChem CID 22482821.
What is the molecular formula of 5-Chloro-2-fluorophenol?
The molecular formula is C6H4ClFO.
What is the molecular weight of 5-Chloro-2-fluorophenol?
The molecular weight is 146.54 g/mol.
What is the IUPAC name of 5-Chloro-2-fluorophenol?
The IUPAC name is 5-chloro-2-fluorophenol.
What is the InChI of 5-Chloro-2-fluorophenol?
The InChI is InChI=1S/C6H4ClFO/c7-4-1-2-5(8)6(9)3-4/h1-3,9H.
What is the InChIKey of 5-Chloro-2-fluorophenol?
The InChIKey is OYEGPBZYKCARCW-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Chloro-2-fluorophenol?
The canonical SMILES is C1=CC(=C(C=C1Cl)O)F.
What is the CAS number of 5-Chloro-2-fluorophenol?
The CAS number is 186589-76-4.
What is the EC number of 5-Chloro-2-fluorophenol?
The EC number is 672-511-2.
Is 5-Chloro-2-fluorophenol a canonicalized compound?
Yes, 5-Chloro-2-fluorophenol is a canonicalized compound.