What is the PubChem CID of the compound 5-Carboxyphthalide?
The PubChem CID of 5-Carboxyphthalide is 78517.
What is the molecular formula of 5-Carboxyphthalide?
The molecular formula of 5-Carboxyphthalide is C9H6O4.
What are the synonyms of 5-Carboxyphthalide?
Some synonyms of 5-Carboxyphthalide include 1-Oxo-1,3-dihydroisobenzofuran-5-carboxylic acid and 5-Isobenzofurancarboxylic acid, 1,3-dihydro-1-oxo.
What is the molecular weight of 5-Carboxyphthalide?
The molecular weight of 5-Carboxyphthalide is 178.14 g/mol.
When was 5-Carboxyphthalide created and modified?
5-Carboxyphthalide was created on August 8, 2005, and modified on November 25, 2023.
What is the IUPAC name of 5-Carboxyphthalide?
The IUPAC name of 5-Carboxyphthalide is 1-oxo-3H-2-benzofuran-5-carboxylic acid.
What is the InChI of 5-Carboxyphthalide?
The InChI of 5-Carboxyphthalide is InChI=1S/C9H6O4/c10-8(11)5-1-2-7-6(3-5)4-13-9(7)12/h1-3H,4H2,(H,10,11).
What is the InChIKey of 5-Carboxyphthalide?
The InChIKey of 5-Carboxyphthalide is QTWUWCFGWYYRRL-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Carboxyphthalide?
The canonical SMILES of 5-Carboxyphthalide is C1C2=C(C=CC(=C2)C(=O)O)C(=O)O1.
What is the CAS number of 5-Carboxyphthalide?
The CAS number of 5-Carboxyphthalide is 4792-29-4.