What is the molecular formula of 5-Bromonicotinic acid?
The molecular formula of 5-Bromonicotinic acid is C6H4BrNO2.
What is the molecular weight of 5-Bromonicotinic acid?
The molecular weight of 5-Bromonicotinic acid is 202.01 g/mol.
What is the IUPAC name of 5-Bromonicotinic acid?
The IUPAC name of 5-Bromonicotinic acid is 5-bromopyridine-3-carboxylic acid.
What is the InChI of 5-Bromonicotinic acid?
The InChI of 5-Bromonicotinic acid is InChI=1S/C6H4BrNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10).
What is the InChIKey of 5-Bromonicotinic acid?
The InChIKey of 5-Bromonicotinic acid is FQIUCPGDKPXSLL-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromonicotinic acid?
The canonical SMILES of 5-Bromonicotinic acid is C1=C(C=NC=C1Br)C(=O)O.
What is the CAS number of 5-Bromonicotinic acid?
The CAS number of 5-Bromonicotinic acid is 20826-04-4.
How many hydrogen bond donor counts does 5-Bromonicotinic acid have?
5-Bromonicotinic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5-Bromonicotinic acid have?
5-Bromonicotinic acid has 3 hydrogen bond acceptor counts.