What is the molecular formula of 5-bromobenzothiazole?
The molecular formula of 5-bromobenzothiazole is C7H4BrNS.
What is the molecular weight of 5-bromobenzothiazole?
The molecular weight of 5-bromobenzothiazole is 214.08 g/mol.
What is the IUPAC name of 5-bromobenzothiazole?
The IUPAC name of 5-bromobenzothiazole is 5-bromo-1,3-benzothiazole.
What is the InChI of 5-bromobenzothiazole?
The InChI of 5-bromobenzothiazole is InChI=1S/C7H4BrNS/c8-5-1-2-7-6(3-5)9-4-10-7/h1-4H.
What is the InChIKey of 5-bromobenzothiazole?
The InChIKey of 5-bromobenzothiazole is KFDDRUWQFQJGNL-UHFFFAOYSA-N.
What is the canonical SMILES of 5-bromobenzothiazole?
The canonical SMILES of 5-bromobenzothiazole is C1=CC2=C(C=C1Br)N=CS2.
What is the CAS number of 5-bromobenzothiazole?
The CAS number of 5-bromobenzothiazole is 768-11-6.
What is the European Community (EC) number of 5-bromobenzothiazole?
The European Community (EC) number of 5-bromobenzothiazole is 805-001-7.
What is the DSSTox Substance ID of 5-bromobenzothiazole?
The DSSTox Substance ID of 5-bromobenzothiazole is DTXSID40394152.
Is 5-bromobenzothiazole a canonicalized compound?
Yes, 5-bromobenzothiazole is a canonicalized compound.