The molecular formula of the compound is C7H7BBrFO2.
What are the synonyms of the compound?
The synonyms of the compound are 5-Bromo-2-fluoro-4-methylphenylboronic acid, 957061-14-2, (5-bromo-2-fluoro-4-methylphenyl)boronic acid, MFCD09258744, and more.
What is the molecular weight of the compound?
The molecular weight of the compound is 232.84 g/mol.
When was the compound created and last modified?
The compound was created on January 26, 2010, and last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (5-bromo-2-fluoro-4-methylphenyl)boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H7BBrFO2/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3,11-12H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is HTOASIJHHJJWRV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=CC(=C(C=C1F)C)Br)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 957061-14-2.
※ Please kindly note that our products are for research use only.