5-Bromo-2-fluoro-3-methylphenylboronic acid

• CAS: 957120-61-5
• Catalog Number: ACM957120615
• Category: Boronic Acids
• Molecular Weight: 232.84
• Molecular Formula: C₇H₇BBrFO₂

Custom Q&A

What is the molecular formula of 5-Bromo-2-fluoro-3-methylphenylboronic acid?

The molecular formula of 5-Bromo-2-fluoro-3-methylphenylboronic acid is C7H7BBrFO2.

What is the molecular weight of 5-Bromo-2-fluoro-3-methylphenylboronic acid?

The molecular weight of 5-Bromo-2-fluoro-3-methylphenylboronic acid is 232.84 g/mol.

What is the IUPAC name of 5-Bromo-2-fluoro-3-methylphenylboronic acid?

The IUPAC name of 5-Bromo-2-fluoro-3-methylphenylboronic acid is (5-bromo-2-fluoro-3-methylphenyl)boronic acid.

What is the InChI of 5-Bromo-2-fluoro-3-methylphenylboronic acid?

The InChI of 5-Bromo-2-fluoro-3-methylphenylboronic acid is InChI=1S/C7H7BBrFO2/c1-4-2-5(9)3-6(7(4)10)8(11)12/h2-3,11-12H,1H3.

What is the InChIKey of 5-Bromo-2-fluoro-3-methylphenylboronic acid?

The InChIKey of 5-Bromo-2-fluoro-3-methylphenylboronic acid is VLFDXHTXMHURJH-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-2-fluoro-3-methylphenylboronic acid?

The canonical SMILES of 5-Bromo-2-fluoro-3-methylphenylboronic acid is B(C1=CC(=CC(=C1F)C)Br)(O)O.

What is the CAS number of 5-Bromo-2-fluoro-3-methylphenylboronic acid?

The CAS number of 5-Bromo-2-fluoro-3-methylphenylboronic acid is 957120-61-5.

How many hydrogen bond donor counts does 5-Bromo-2-fluoro-3-methylphenylboronic acid have?

5-Bromo-2-fluoro-3-methylphenylboronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 5-Bromo-2-fluoro-3-methylphenylboronic acid have?

5-Bromo-2-fluoro-3-methylphenylboronic acid has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 5-Bromo-2-fluoro-3-methylphenylboronic acid?

The topological polar surface area of 5-Bromo-2-fluoro-3-methylphenylboronic acid is 40.5 Ų.