What is the molecular formula of 5-Bromo-2-chlorotoluene?
The molecular formula of 5-Bromo-2-chlorotoluene is C7H6BrCl.
What is the IUPAC name of 5-Bromo-2-chlorotoluene?
The IUPAC name of 5-Bromo-2-chlorotoluene is 4-bromo-1-chloro-2-methylbenzene.
What is the InChI of 5-Bromo-2-chlorotoluene?
The InChI of 5-Bromo-2-chlorotoluene is InChI=1S/C7H6BrCl/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3.
What is the InChIKey of 5-Bromo-2-chlorotoluene?
The InChIKey of 5-Bromo-2-chlorotoluene is OZFQMHJKAODEON-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-chlorotoluene?
The canonical SMILES of 5-Bromo-2-chlorotoluene is CC1=C(C=CC(=C1)Br)Cl.
What is the CAS number of 5-Bromo-2-chlorotoluene?
The CAS number of 5-Bromo-2-chlorotoluene is 54932-72-8.
What is the molecular weight of 5-Bromo-2-chlorotoluene?
The molecular weight of 5-Bromo-2-chlorotoluene is 205.48 g/mol.
What is the XLogP3 value of 5-Bromo-2-chlorotoluene?
The XLogP3 value of 5-Bromo-2-chlorotoluene is 4.1.
How many hydrogen bond donor counts does 5-Bromo-2-chlorotoluene have?
5-Bromo-2-chlorotoluene has 0 hydrogen bond donor counts.
How many rotatable bond counts does 5-Bromo-2-chlorotoluene have?
5-Bromo-2-chlorotoluene has 0 rotatable bond counts.