What is the molecular formula of 5-Bromo-1-methyl-indole?
The molecular formula of 5-Bromo-1-methyl-indole is C9H8BrN.
What is the molecular weight of 5-Bromo-1-methyl-indole?
The molecular weight of 5-Bromo-1-methyl-indole is 210.07 g/mol.
What is the IUPAC name of 5-Bromo-1-methyl-indole?
The IUPAC name of 5-Bromo-1-methyl-indole is 5-bromo-1-methylindole.
What is the InChI of 5-Bromo-1-methyl-indole?
The InChI of 5-Bromo-1-methyl-indole is InChI=1S/C9H8BrN/c1-11-5-4-7-6-8(10)2-3-9(7)11/h2-6H,1H3.
What is the InChIKey of 5-Bromo-1-methyl-indole?
The InChIKey of 5-Bromo-1-methyl-indole is SBOITLSQLQGSLO-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-1-methyl-indole?
The canonical SMILES of 5-Bromo-1-methyl-indole is CN1C=CC2=C1C=CC(=C2)Br.
What is the CAS number of 5-Bromo-1-methyl-indole?
The CAS number of 5-Bromo-1-methyl-indole is 10075-52-2.
What is the EC number of 5-Bromo-1-methyl-indole?
The EC number of 5-Bromo-1-methyl-indole is 687-025-6.
What is the DSSTox Substance ID of 5-Bromo-1-methyl-indole?
The DSSTox Substance ID of 5-Bromo-1-methyl-indole is DTXSID20301420.
Is 5-Bromo-1-methyl-indole a canonicalized compound?
Yes, 5-Bromo-1-methyl-indole is a canonicalized compound.