What is the molecular formula of the compound?
The molecular formula of the compound is C18H22BNO3.
What are the synonyms of the compound?
The synonyms of the compound are 1375302-99-0, 3-(benzyloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 3-BENZYLOXY-PYRIDINE-5-BORONIC ACID PINACOL ESTER, 3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, and pyridine, 3-(phenylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-.
What is the molecular weight of the compound?
The molecular weight of the compound is 311.2 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C18H22BNO3/c1-17(2)18(3,4)23-19(22-17)15-10-16(12-20-11-15)21-13-14-8-6-5-7-9-14/h5-12H,13H2,1-4H3.
What is the InChIKey of the compound?
The InChIKey of the compound is NAOLHUUUJHXGFQ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)OCC3=CC=CC=C3.
What is the CAS number of the compound?
The CAS number of the compound is 1375302-99-0.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 815-537-3.
Is the compound canonicalized?
Yes, the compound is canonicalized.