What is the molecular formula of 5-(Benzyloxy)-2-methylphenylboronic acid?
The molecular formula is C14H15BO3.
What are the synonyms of 5-(Benzyloxy)-2-methylphenylboronic acid?
The synonyms are 1451391-56-2, (5-(Benzyloxy)-2-methylphenyl)boronic acid, (2-methyl-5-phenylmethoxyphenyl)boronic acid, and PHZUZAMBWZEFSP-UHFFFAOYSA-N.
When was 5-(Benzyloxy)-2-methylphenylboronic acid created?
It was created on March 8, 2012.
What is the IUPAC name of 5-(Benzyloxy)-2-methylphenylboronic acid?
The IUPAC name is (2-methyl-5-phenylmethoxyphenyl)boronic acid.
What is the InChI of 5-(Benzyloxy)-2-methylphenylboronic acid?
The InChI is InChI=1S/C14H15BO3/c1-11-7-8-13(9-14(11)15(16)17)18-10-12-5-3-2-4-6-12/h2-9,16-17H,10H2,1H3.
What is the InChIKey of 5-(Benzyloxy)-2-methylphenylboronic acid?
The InChIKey is PHZUZAMBWZEFSP-UHFFFAOYSA-N.
What is the canonical SMILES of 5-(Benzyloxy)-2-methylphenylboronic acid?
The canonical SMILES is B(C1=C(C=CC(=C1)OCC2=CC=CC=C2)C)(O)O.
What is the molecular weight of 5-(Benzyloxy)-2-methylphenylboronic acid?
The molecular weight is 242.08 g/mol.
How many hydrogen bond donor counts does 5-(Benzyloxy)-2-methylphenylboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5-(Benzyloxy)-2-methylphenylboronic acid have?
It has 3 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.