What is the molecular formula of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid?
The molecular formula of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid is C14H13BFNO3.
What is the molecular weight of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid?
The molecular weight of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid is 273.07 g/mol.
What is the PubChem CID of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid?
The PubChem CID of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid is 44717483.
What is the IUPAC name of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid?
The IUPAC name of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid is [5-(benzylcarbamoyl)-2-fluorophenyl]boronic acid.
What is the InChI of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid?
The InChI of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid is InChI=1S/C14H13BFNO3/c16-13-7-6-11(8-12(13)15(19)20)14(18)17-9-10-4-2-1-3-5-10/h1-8,19-20H,9H2,(H,17,18).
What is the InChIKey of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid?
The InChIKey of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid is REOKRXJQZIVZIB-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid?
The Canonical SMILES of 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid is B(C1=C(C=CC(=C1)C(=O)NCC2=CC=CC=C2)F)(O)O.
How many hydrogen bond donor counts does 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid have?
5-(Benzylcarbamoyl)-2-fluorophenylboronic acid has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid have?
5-(Benzylcarbamoyl)-2-fluorophenylboronic acid has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 5-(Benzylcarbamoyl)-2-fluorophenylboronic acid have?
5-(Benzylcarbamoyl)-2-fluorophenylboronic acid has 4 rotatable bond counts.
※ Please kindly note that our products are for research use only.