What is the PubChem CID of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The PubChem CID of 5-Benzyl-thiazol-2-ylamine hydrochloride is 45792462.
What is the molecular formula of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The molecular formula of 5-Benzyl-thiazol-2-ylamine hydrochloride is C10H11ClN2S.
What are the synonyms of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The synonyms of 5-Benzyl-thiazol-2-ylamine hydrochloride are 5-benzyl-1,3-thiazol-2-amine hydrochloride, 1210365-48-2, and 5-benzyl-1,3-thiazol-2-amine.
What is the molecular weight of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The molecular weight of 5-Benzyl-thiazol-2-ylamine hydrochloride is 226.73 g/mol.
What is the IUPAC name of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The IUPAC name of 5-Benzyl-thiazol-2-ylamine hydrochloride is 5-benzyl-1,3-thiazol-2-amine;hydrochloride.
What is the InChI of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The InChI of 5-Benzyl-thiazol-2-ylamine hydrochloride is InChI=1S/C10H10N2S.ClH/c11-10-12-7-9(13-10)6-8-4-2-1-3-5-8;/h1-5,7H,6H2,(H2,11,12);1H.
What is the InChIKey of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The InChIKey of 5-Benzyl-thiazol-2-ylamine hydrochloride is ULAQYRGGOOBOLJ-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The canonical SMILES of 5-Benzyl-thiazol-2-ylamine hydrochloride is C1=CC=C(C=C1)CC2=CN=C(S2)N.Cl.
What is the hydrogen bond donor count of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The hydrogen bond donor count of 5-Benzyl-thiazol-2-ylamine hydrochloride is 2.
What is the hydrogen bond acceptor count of 5-Benzyl-thiazol-2-ylamine hydrochloride?
The hydrogen bond acceptor count of 5-Benzyl-thiazol-2-ylamine hydrochloride is 3.
※ Please kindly note that our products are for research use only.