What is the molecular formula of (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester?
The molecular formula is C11H15FN2O2.
What are some synonyms for (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester?
Some synonyms include tert-butyl N-(5-amino-2-fluorophenyl)carbamate, tert-butyl(5-amino-2-fluorophenyl)carbamate, and (5-AMINO-2-FLUORO-PHENYL)-CARBAMIC ACID TERT-BUTYL ESTER.
What is the molecular weight of (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester?
The molecular weight is 226.25 g/mol.
What is the IUPAC name of (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester?
The IUPAC name is tert-butyl N-(5-amino-2-fluorophenyl)carbamate.
What is the InChI of (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester?
The InChI is InChI=1S/C11H15FN2O2/c1-11(2,3)16-10(15)14-9-6-7(13)4-5-8(9)12/h4-6H,13H2,1-3H3,(H,14,15).
What is the InChIKey of (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester?
The InChIKey is FIRABEKBYKPYIS-UHFFFAOYSA-N.
What is the Canonical SMILES of (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester?
The Canonical SMILES is CC(C)(C)OC(=O)NC1=C(C=CC(=C1)N)F.
What is the CAS number of (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester?
The CAS number is 535170-18-4.
Is (5-Amino-2-fluoro-phenyl)-carbamic acid tert-butyl ester a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.