What is the molecular formula of zymosterol?
The molecular formula of zymosterol is C27H44O.
What is the molecular weight of zymosterol?
The molecular weight of zymosterol is 384.6 g/mol.
What is the IUPAC name of zymosterol?
The IUPAC name of zymosterol is (3S,5S,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
What is the InChI of zymosterol?
The InChI of zymosterol is InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21,23-,24,26+,27-/m1/s1.
What is the InChIKey of zymosterol?
The InChIKey of zymosterol is CGSJXLIKVBJVRY-XTGBIJOFSA-N.
What is the canonical SMILES of zymosterol?
The canonical SMILES of zymosterol is CC(CCC=C(C)C)C1CCC2C1(CCC3=C2CCC4C3(CCC(C4)O)C).
What is the CAS number of zymosterol?
The CAS number of zymosterol is 128-33-6.
What is the European Community (EC) number of zymosterol?
The European Community (EC) number of zymosterol is 204-880-9.
What is the UNII of zymosterol?
The UNII of zymosterol is PU2755PT4O.
What is the Lipid Maps ID (LM_ID) of zymosterol?
The Lipid Maps ID (LM_ID) of zymosterol is LMST01010066.