What is the molecular formula of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The molecular formula of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is C12H14O4S.
What is the molecular weight of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The molecular weight of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is 254.30 g/mol.
What is the IUPAC name of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The IUPAC name of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is 2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]acetic acid.
What is the InChI of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The InChI of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is InChI=1S/C12H14O4S/c1-8(13)9-3-4-11(16-2)10(5-9)6-17-7-12(14)15/h3-5H,6-7H2,1-2H3,(H,14,15).
What is the InChIKey of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The InChIKey of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is VUNKZEGEXUAKHA-UHFFFAOYSA-N.
What is the canonical SMILES of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The canonical SMILES of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is CC(=O)C1=CC(=C(C=C1)OC)CSCC(=O)O.
What is the CAS number of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The CAS number of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is 795290-98-1.
What is the ChEMBL ID of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The ChEMBL ID of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is CHEMBL1560227.
What is the XLogP3-AA value of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The XLogP3-AA value of [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is 1.6.
What is the hydrogen bond donor count and hydrogen bond acceptor count for [(5-Acetyl-2-methoxybenzyl)thio]acetic acid?
The hydrogen bond donor count for [(5-Acetyl-2-methoxybenzyl)thio]acetic acid is 1, and the hydrogen bond acceptor count is 5.
※ Please kindly note that our products are for research use only.