What is the molecular formula of 5,6-Dihydroxyindoline?
The molecular formula is C8H9NO2.
What are some synonyms for 5,6-Dihydroxyindoline?
Some synonyms are Indoline-5,6-diol and 5,6-Indolinediol.
What is the molecular weight of 5,6-Dihydroxyindoline?
The molecular weight is 151.16 g/mol.
What is the IUPAC name of 5,6-Dihydroxyindoline?
The IUPAC name is 2,3-dihydro-1H-indole-5,6-diol.
What is the InChI of 5,6-Dihydroxyindoline?
The InChI is InChI=1S/C8H9NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h3-4,9-11H,1-2H2.
How many hydrogen bond donor counts does 5,6-Dihydroxyindoline have?
It has 3 hydrogen bond donor counts.
What is the XLogP3-AA value of 5,6-Dihydroxyindoline?
The XLogP3-AA value is 1.2.
How many rotatable bond counts does 5,6-Dihydroxyindoline have?
It has 0 rotatable bond counts.
What is the topological polar surface area of 5,6-Dihydroxyindoline?
The topological polar surface area is 52.5Ų.
What is the physical description of 5,6-Dihydroxyindoline?
It is a solid.