--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is (4R,5R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]hexanoic acid.
The molecular weight of the compound is 425.5 g/mol.
The InChI of the compound is InChI=1S/C25H31NO5/c1-16(31-25(2,3)4)22(13-14-23(27)28)26-24(29)30-15-21-19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h5-12,16,21-22H,13-15H2,1-4H3,(H,26,29)(H,27,28)/t16-,22-/m1/s1.
The canonical SMILES of the compound is CC(C(CCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C).
The hydrogen bond donor count of the compound is 2.
The hydrogen bond acceptor count of the compound is 5.
The rotatable bond count of the compound is 10.
The topological polar surface area of the compound is 84.9Ų.
The heavy atom count of the compound is 31.
Yes, the compound is canonicalized.
Download
×