What is the molecular formula of 4-(Thiophen-3-yl)aniline?
The molecular formula of 4-(Thiophen-3-yl)aniline is C10H9NS.
What is the molecular weight of 4-(Thiophen-3-yl)aniline?
The molecular weight of 4-(Thiophen-3-yl)aniline is 175.25 g/mol.
What is the IUPAC name of 4-(Thiophen-3-yl)aniline?
The IUPAC name of 4-(Thiophen-3-yl)aniline is 4-thiophen-3-ylaniline.
What is the InChI code of 4-(Thiophen-3-yl)aniline?
The InChI code of 4-(Thiophen-3-yl)aniline is InChI=1S/C10H9NS/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-7H,11H2.
What is the InChIKey of 4-(Thiophen-3-yl)aniline?
The InChIKey of 4-(Thiophen-3-yl)aniline is GYPDHLDQINBFPY-UHFFFAOYSA-N.
What is the canonical SMILES of 4-(Thiophen-3-yl)aniline?
The canonical SMILES of 4-(Thiophen-3-yl)aniline is C1=CC(=CC=C1C2=CSC=C2)N.
What is the CAS number of 4-(Thiophen-3-yl)aniline?
The CAS number of 4-(Thiophen-3-yl)aniline is 834884-74-1.
What is the EC number of 4-(Thiophen-3-yl)aniline?
The EC number of 4-(Thiophen-3-yl)aniline is 624-851-8.
Is 4-(Thiophen-3-yl)aniline a canonicalized compound?
Yes, 4-(Thiophen-3-yl)aniline is a canonicalized compound according to PubChem.