What is the molecular formula of 4-Sulfophthalic acid?
The molecular formula of 4-Sulfophthalic acid is C8H6O7S.
What is the molecular weight of 4-Sulfophthalic acid?
The molecular weight of 4-Sulfophthalic acid is 246.20 g/mol.
What is the IUPAC name of 4-Sulfophthalic acid?
The IUPAC name of 4-Sulfophthalic acid is 4-sulfophthalic acid.
What is the InChI of 4-Sulfophthalic acid?
The InChI of 4-Sulfophthalic acid is InChI=1S/C8H6O7S/c9-7(10)5-2-1-4(16(13,14)15)3-6(5)8(11)12/h1-3H,(H,9,10)(H,11,12)(H,13,14,15).
What is the InChIKey of 4-Sulfophthalic acid?
The InChIKey of 4-Sulfophthalic acid is WNKQDGLSQUASME-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Sulfophthalic acid?
The canonical SMILES of 4-Sulfophthalic acid is C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)C(=O)O.
What is the CAS number of 4-Sulfophthalic acid?
The CAS number of 4-Sulfophthalic acid is 89-08-7.
What is the XLogP3-AA value of 4-Sulfophthalic acid?
The XLogP3-AA value of 4-Sulfophthalic acid is -0.3.
How many hydrogen bond donor count does 4-Sulfophthalic acid have?
4-Sulfophthalic acid has 3 hydrogen bond donor count.