What is the molecular formula of 4-Propoxybenzonitrile?
The molecular formula of 4-Propoxybenzonitrile is C10H11NO.
What is the molecular weight of 4-Propoxybenzonitrile?
The molecular weight of 4-Propoxybenzonitrile is 161.20 g/mol.
What is the IUPAC name of 4-Propoxybenzonitrile?
The IUPAC name of 4-Propoxybenzonitrile is 4-propoxybenzonitrile.
What is the InChI of 4-Propoxybenzonitrile?
The InChI of 4-Propoxybenzonitrile is InChI=1S/C10H11NO/c1-2-7-12-10-5-3-9(8-11)4-6-10/h3-6H,2,7H2,1H3.
What is the InChIKey of 4-Propoxybenzonitrile?
The InChIKey of 4-Propoxybenzonitrile is VYOPNUZYNSNYRA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Propoxybenzonitrile?
The canonical SMILES of 4-Propoxybenzonitrile is CCCOC1=CC=C(C=C1)C#N.
What is the CAS number of 4-Propoxybenzonitrile?
The CAS number of 4-Propoxybenzonitrile is 60758-84-1.
What is the hydrogen bond donor count of 4-Propoxybenzonitrile?
The hydrogen bond donor count of 4-Propoxybenzonitrile is 0.
What is the hydrogen bond acceptor count of 4-Propoxybenzonitrile?
The hydrogen bond acceptor count of 4-Propoxybenzonitrile is 2.
Is 4-Propoxybenzonitrile a canonicalized compound?
Yes, 4-Propoxybenzonitrile is a canonicalized compound according to PubChem.