What is the molecular formula of 4-Pregnene-3,11,20-trione?
The molecular formula of 4-Pregnene-3,11,20-trione is C21H28O3.
What is the molecular weight of 4-Pregnene-3,11,20-trione?
The molecular weight of 4-Pregnene-3,11,20-trione is 328.4 g/mol.
What is the IUPAC name of 4-Pregnene-3,11,20-trione?
The IUPAC name of 4-Pregnene-3,11,20-trione is (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-dione.
What is the InChI of 4-Pregnene-3,11,20-trione?
The InChI of 4-Pregnene-3,11,20-trione is InChI=1S/C21H28O3/c1-12(22)16-6-7-17-15-5-4-13-10-14(23)8-9-20(13,2)19(15)18(24)11-21(16,17)3/h10,15-17,19H,4-9,11H2,1-3H3/t15-,16+,17-,19+,20-,21+/m0/s1.
What is the InChIKey of 4-Pregnene-3,11,20-trione?
The InChIKey of 4-Pregnene-3,11,20-trione is WKAVAGKRWFGIEA-DADBAOPHSA-N.
What is the canonical SMILES of 4-Pregnene-3,11,20-trione?
The canonical SMILES of 4-Pregnene-3,11,20-trione is CC(=O)C1CCC2C1(CC(=O)C3C2CCC4=CC(=O)CCC34C)C.
What is the CAS number of 4-Pregnene-3,11,20-trione?
The CAS number of 4-Pregnene-3,11,20-trione is 516-15-4.
What is the EC number of 4-Pregnene-3,11,20-trione?
The EC number of 4-Pregnene-3,11,20-trione is 208-222-1.
What is the ChEMBL ID of 4-Pregnene-3,11,20-trione?
The ChEMBL ID of 4-Pregnene-3,11,20-trione is CHEMBL284253.