What is the molecular formula of 4-Phenyl-3-butyn-2-ol?
The molecular formula of 4-Phenyl-3-butyn-2-ol is C10H10O.
What is the molecular weight of 4-Phenyl-3-butyn-2-ol?
The molecular weight of 4-Phenyl-3-butyn-2-ol is 146.19 g/mol.
What is the IUPAC name of 4-Phenyl-3-butyn-2-ol?
The IUPAC name of 4-Phenyl-3-butyn-2-ol is 4-phenylbut-3-yn-2-ol.
What is the InChI of 4-Phenyl-3-butyn-2-ol?
The InChI of 4-Phenyl-3-butyn-2-ol is InChI=1S/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9,11H,1H3.
What is the InChIKey of 4-Phenyl-3-butyn-2-ol?
The InChIKey of 4-Phenyl-3-butyn-2-ol is JYOZFNMFSVAZAW-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Phenyl-3-butyn-2-ol?
The canonical SMILES of 4-Phenyl-3-butyn-2-ol is CC(C#CC1=CC=CC=C1)O.
What is the CAS number of 4-Phenyl-3-butyn-2-ol?
The CAS number of 4-Phenyl-3-butyn-2-ol is 5876-76-6.
What is the European Community (EC) number of 4-Phenyl-3-butyn-2-ol?
The European Community (EC) number of 4-Phenyl-3-butyn-2-ol is 627-391-6.
Is 4-Phenyl-3-butyn-2-ol a canonicalized compound?
Yes, 4-Phenyl-3-butyn-2-ol is a canonicalized compound according to PubChem.