What is the molecular formula of 4-Phenoxybenzylamine?
The molecular formula of 4-Phenoxybenzylamine is C13H13NO.
What is the molecular weight of 4-Phenoxybenzylamine?
The molecular weight of 4-Phenoxybenzylamine is 199.25 g/mol.
What is the IUPAC name of 4-Phenoxybenzylamine?
The IUPAC name of 4-Phenoxybenzylamine is (4-phenoxyphenyl)methanamine.
What is the InChI description of 4-Phenoxybenzylamine?
The InChI description of 4-Phenoxybenzylamine is InChI=1S/C13H13NO/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h1-9H,10,14H2.
What is the InChIKey of 4-Phenoxybenzylamine?
The InChIKey of 4-Phenoxybenzylamine is CCAZAGUSBMVSAR-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Phenoxybenzylamine?
The canonical SMILES of 4-Phenoxybenzylamine is C1=CC=C(C=C1)OC2=CC=C(C=C2)CN.
What is the CAS number of 4-Phenoxybenzylamine?
The CAS number of 4-Phenoxybenzylamine is 107622-80-0.
What is the European Community (EC) number of 4-Phenoxybenzylamine?
The European Community (EC) number of 4-Phenoxybenzylamine is 671-210-3.
What is the XLogP3-AA value of 4-Phenoxybenzylamine?
The XLogP3-AA value of 4-Phenoxybenzylamine is 2.3.
Is 4-Phenoxybenzylamine a canonicalized compound?
Yes, 4-Phenoxybenzylamine is a canonicalized compound.