What is the molecular formula of 4-Phenoxyaniline?
The molecular formula of 4-Phenoxyaniline is C12H11NO.
What is the molecular weight of 4-Phenoxyaniline?
The molecular weight of 4-Phenoxyaniline is 185.22 g/mol.
What is the IUPAC name of 4-Phenoxyaniline?
The IUPAC name of 4-Phenoxyaniline is 4-phenoxyaniline.
What is the InChIKey of 4-Phenoxyaniline?
The InChIKey of 4-Phenoxyaniline is WOYZXEVUWXQVNV-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Phenoxyaniline?
The canonical SMILES of 4-Phenoxyaniline is C1=CC=C(C=C1)OC2=CC=C(C=C2)N.
What is the CAS number of 4-Phenoxyaniline?
The CAS number of 4-Phenoxyaniline is 139-59-3.
How many hydrogen bond donor counts does 4-Phenoxyaniline have?
4-Phenoxyaniline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-Phenoxyaniline have?
4-Phenoxyaniline has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 4-Phenoxyaniline?
The topological polar surface area of 4-Phenoxyaniline is 35.2 ?2.
How many rotatable bond counts does 4-Phenoxyaniline have?
4-Phenoxyaniline has 2 rotatable bond counts.