What is the molecular formula of 4-(Octyloxy)phenol?
The molecular formula of 4-(Octyloxy)phenol is C14H22O2.
What is the molecular weight of 4-(Octyloxy)phenol?
The molecular weight of 4-(Octyloxy)phenol is 222.32 g/mol.
What is the IUPAC name of 4-(Octyloxy)phenol?
The IUPAC name of 4-(Octyloxy)phenol is 4-octoxyphenol.
What is the InChI of 4-(Octyloxy)phenol?
The InChI of 4-(Octyloxy)phenol is InChI=1S/C14H22O2/c1-2-3-4-5-6-7-12-16-14-10-8-13(15)9-11-14/h8-11,15H,2-7,12H2,1H3.
What is the InChIKey of 4-(Octyloxy)phenol?
The InChIKey of 4-(Octyloxy)phenol is HFRUPPHPJRZOCM-UHFFFAOYSA-N.
What is the canonical SMILES of 4-(Octyloxy)phenol?
The canonical SMILES of 4-(Octyloxy)phenol is CCCCCCCCOC1=CC=C(C=C1)O.
What is the CAS number of 4-(Octyloxy)phenol?
The CAS number of 4-(Octyloxy)phenol is 3780-50-5.
What is the European Community (EC) number of 4-(Octyloxy)phenol?
The European Community (EC) number of 4-(Octyloxy)phenol is 223-243-6.
What is the DSSTox Substance ID of 4-(Octyloxy)phenol?
The DSSTox Substance ID of 4-(Octyloxy)phenol is DTXSID1063190.
What is the complexity of 4-(Octyloxy)phenol?
The complexity of 4-(Octyloxy)phenol is 151.