What is the PubChem CID for 4-Nitro-n-propylbenzylamine hydrochloride?
The PubChem CID for 4-Nitro-n-propylbenzylamine hydrochloride is 109563.
What is the molecular formula of 4-Nitro-n-propylbenzylamine hydrochloride?
The molecular formula of 4-Nitro-n-propylbenzylamine hydrochloride is C10H15ClN2O2.
What are the synonyms of 4-Nitro-n-propylbenzylamine hydrochloride?
The synonyms of 4-Nitro-n-propylbenzylamine hydrochloride are 68133-98-2, N-4-Nitrobenzyl-n-propylamine hydrochloride, Benzenemethanamine, 4-nitro-N-propyl-, monohydrochloride, N-(4-Nitrobenzyl)propylamine hydrochloride, and more.
What is the molecular weight of 4-Nitro-n-propylbenzylamine hydrochloride?
The molecular weight of 4-Nitro-n-propylbenzylamine hydrochloride is 230.69 g/mol.
What is the IUPAC name of 4-Nitro-n-propylbenzylamine hydrochloride?
The IUPAC name of 4-Nitro-n-propylbenzylamine hydrochloride is N-[(4-nitrophenyl)methyl]propan-1-amine hydrochloride.
What is the InChI of 4-Nitro-n-propylbenzylamine hydrochloride?
The InChI of 4-Nitro-n-propylbenzylamine hydrochloride is InChI=1S/C10H14N2O2.ClH/c1-2-7-11-8-9-3-5-10(6-4-9)12(13)14;/h3-6,11H,2,7-8H2,1H3;1H.
What is the InChIKey of 4-Nitro-n-propylbenzylamine hydrochloride?
The InChIKey of 4-Nitro-n-propylbenzylamine hydrochloride is LWISLZIFEARHJI-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Nitro-n-propylbenzylamine hydrochloride?
The canonical SMILES of 4-Nitro-n-propylbenzylamine hydrochloride is CCCNCC1=CC=C(C=C1)[N+](=O)[O-].Cl.
What is the CAS number of 4-Nitro-n-propylbenzylamine hydrochloride?
The CAS number of 4-Nitro-n-propylbenzylamine hydrochloride is 68133-98-2.
※ Please kindly note that our products are for research use only.