What is the molecular formula of 4-N-Propoxybromobenzene?
The molecular formula of 4-N-Propoxybromobenzene is C9H11BrO.
What is the molecular weight of 4-N-Propoxybromobenzene?
The molecular weight of 4-N-Propoxybromobenzene is 215.09 g/mol.
What is the IUPAC name of 4-N-Propoxybromobenzene?
The IUPAC name of 4-N-Propoxybromobenzene is 1-bromo-4-propoxybenzene.
What is the InChI of 4-N-Propoxybromobenzene?
The InChI of 4-N-Propoxybromobenzene is InChI=1S/C9H11BrO/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6H,2,7H2,1H3.
What is the InChIKey of 4-N-Propoxybromobenzene?
The InChIKey of 4-N-Propoxybromobenzene is VVPARGBRVKRZJC-UHFFFAOYSA-N.
What is the canonical SMILES of 4-N-Propoxybromobenzene?
The canonical SMILES of 4-N-Propoxybromobenzene is CCCOC1=CC=C(C=C1)Br.
What is the CAS number of 4-N-Propoxybromobenzene?
The CAS number of 4-N-Propoxybromobenzene is 39969-56-7.
How many hydrogen bond donor counts does 4-N-Propoxybromobenzene have?
4-N-Propoxybromobenzene has 0 hydrogen bond donor counts.
How many rotatable bond counts does 4-N-Propoxybromobenzene have?
4-N-Propoxybromobenzene has 3 rotatable bond counts.