What is the chemical formula of 4-Methylbenzyl chloride?
The chemical formula of 4-Methylbenzyl chloride is C8H9Cl.
What is the molecular weight of 4-Methylbenzyl chloride?
The molecular weight of 4-Methylbenzyl chloride is 140.61 g/mol.
What is the IUPAC name of 4-Methylbenzyl chloride?
The IUPAC name of 4-Methylbenzyl chloride is 1-(chloromethyl)-4-methylbenzene.
What is the InChI of 4-Methylbenzyl chloride?
The InChI of 4-Methylbenzyl chloride is InChI=1S/C8H9Cl/c1-7-2-4-8(6-9)5-3-7/h2-5H,6H2,1H3.
What is the InChIKey of 4-Methylbenzyl chloride?
The InChIKey of 4-Methylbenzyl chloride is DMHZDOTYAVHSEH-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methylbenzyl chloride?
The canonical SMILES of 4-Methylbenzyl chloride is CC1=CC=C(C=C1)CCl.
What is the CAS number of 4-Methylbenzyl chloride?
The CAS number of 4-Methylbenzyl chloride is 104-82-5.
What is the XLogP3 value of 4-Methylbenzyl chloride?
The XLogP3 value of 4-Methylbenzyl chloride is 2.9.
Is 4-Methylbenzyl chloride a canonicalized compound?
Yes, 4-Methylbenzyl chloride is a canonicalized compound.