What is the molecular formula of 4-Methyl-3-penten-1-ol?
The molecular formula is C6H12O.
What is the molecular weight of 4-Methyl-3-penten-1-ol?
The molecular weight is 100.16 g/mol.
Is 4-Methyl-3-penten-1-ol a natural product found in Aloe arborescens?
Yes, 4-Methyl-3-penten-1-ol is a natural product found in Aloe arborescens.
What is the IUPAC name of 4-Methyl-3-penten-1-ol?
The IUPAC name is 4-methylpent-3-en-1-ol.
What is the InChI of 4-Methyl-3-penten-1-ol?
The InChI is InChI=1S/C6H12O/c1-6(2)4-3-5-7/h4,7H,3,5H2,1-2H3.
What is the CAS number of 4-Methyl-3-penten-1-ol?
The CAS number is 763-89-3.
What is the XLogP3-AA value of 4-Methyl-3-penten-1-ol?
The XLogP3-AA value is 1.5.
How many hydrogen bond donor count does 4-Methyl-3-penten-1-ol have?
4-Methyl-3-penten-1-ol has 1 hydrogen bond donor count.
What is the topological polar surface area of 4-Methyl-3-penten-1-ol?
The topological polar surface area is 20.2Ų.
How many rotatable bond count does 4-Methyl-3-penten-1-ol have?
4-Methyl-3-penten-1-ol has 2 rotatable bond count.