What is the molecular formula of 4-Methyl-2-pentyne?
The molecular formula of 4-Methyl-2-pentyne is C6H10.
What is the molecular weight of 4-Methyl-2-pentyne?
The molecular weight of 4-Methyl-2-pentyne is 82.14 g/mol.
What is the IUPAC name of 4-Methyl-2-pentyne?
The IUPAC name of 4-Methyl-2-pentyne is 4-methylpent-2-yne.
What is the InChI of 4-Methyl-2-pentyne?
The InChI of 4-Methyl-2-pentyne is InChI=1S/C6H10/c1-4-5-6(2)3/h6H,1-3H3.
What is the InChIKey of 4-Methyl-2-pentyne?
The InChIKey of 4-Methyl-2-pentyne is SLMFWJQZLPEDDU-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methyl-2-pentyne?
The canonical SMILES of 4-Methyl-2-pentyne is CC#CC(C)C.
What is the CAS number of 4-Methyl-2-pentyne?
The CAS number of 4-Methyl-2-pentyne is 21020-27-9.
What is the EC number of 4-Methyl-2-pentyne?
The EC number of 4-Methyl-2-pentyne is 625-476-2.
What is the XLogP3-AA value of 4-Methyl-2-pentyne?
The XLogP3-AA value of 4-Methyl-2-pentyne is 2.2.
Is 4-Methyl-2-pentyne a canonicalized compound?
Yes, 4-Methyl-2-pentyne is a canonicalized compound according to PubChem.