What is the molecular formula of 4-Methyl-1,2,3,4-tetrahydroisoquinoline?
The molecular formula is C10H13N.
When was 4-Methyl-1,2,3,4-tetrahydroisoquinoline created and modified?
It was created on 2007-02-08 and modified on 2023-12-30.
What is the IUPAC name of 4-Methyl-1,2,3,4-tetrahydroisoquinoline?
The IUPAC name is 4-methyl-1,2,3,4-tetrahydroisoquinoline.
What is the InChI of 4-Methyl-1,2,3,4-tetrahydroisoquinoline?
The InChI is InChI=1S/C10H13N/c1-8-6-11-7-9-4-2-3-5-10(8)9/h2-5,8,11H,6-7H2,1H3.
What is the Canonical SMILES of 4-Methyl-1,2,3,4-tetrahydroisoquinoline?
The Canonical SMILES is CC1CNCC2=CC=CC=C12.
What is the molecular weight of 4-Methyl-1,2,3,4-tetrahydroisoquinoline?
The molecular weight is 147.22 g/mol.
What is the XLogP3-AA value of 4-Methyl-1,2,3,4-tetrahydroisoquinoline?
The XLogP3-AA value is 1.7.
How many hydrogen bond donor counts does 4-Methyl-1,2,3,4-tetrahydroisoquinoline have?
It has 1 hydrogen bond donor count.
How many defined atom stereocenter counts does 4-Methyl-1,2,3,4-tetrahydroisoquinoline have?
It has 0 defined atom stereocenter counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.