What is the PubChem CID for [(4-Methoxyphenyl)amino](oxo)acetic acid?
The PubChem CID for [(4-Methoxyphenyl)amino](oxo)acetic acid is 4962374.
What is the molecular formula of [(4-Methoxyphenyl)amino](oxo)acetic acid?
The molecular formula of [(4-Methoxyphenyl)amino](oxo)acetic acid is C9H9NO4.
What are some synonyms for [(4-Methoxyphenyl)amino](oxo)acetic acid?
Some synonyms for [(4-Methoxyphenyl)amino](oxo)acetic acid are 41374-62-3, [(4-methoxyphenyl)amino](oxo)acetic acid, 2-((4-Methoxyphenyl)amino)-2-oxoacetic acid, and [(4-methoxyphenyl)carbamoyl]formic acid.
What is the molecular weight of [(4-Methoxyphenyl)amino](oxo)acetic acid?
The molecular weight of [(4-Methoxyphenyl)amino](oxo)acetic acid is 195.17 g/mol.
What is the IUPAC name of [(4-Methoxyphenyl)amino](oxo)acetic acid?
The IUPAC name of [(4-Methoxyphenyl)amino](oxo)acetic acid is 2-(4-methoxyanilino)-2-oxoacetic acid.
What is the InChI of [(4-Methoxyphenyl)amino](oxo)acetic acid?
The InChI of [(4-Methoxyphenyl)amino](oxo)acetic acid is InChI=1S/C9H9NO4/c1-14-7-4-2-6(3-5-7)10-8(11)9(12)13/h2-5H,1H3,(H,10,11)(H,12,13).
What is the InChIKey of [(4-Methoxyphenyl)amino](oxo)acetic acid?
The InChIKey of [(4-Methoxyphenyl)amino](oxo)acetic acid is OHBNHGKGBOYRSB-UHFFFAOYSA-N.
What is the canonical SMILES of [(4-Methoxyphenyl)amino](oxo)acetic acid?
The canonical SMILES of [(4-Methoxyphenyl)amino](oxo)acetic acid is COC1=CC=C(C=C1)NC(=O)C(=O)O.
What is the CAS number of [(4-Methoxyphenyl)amino](oxo)acetic acid?
The CAS number of [(4-Methoxyphenyl)amino](oxo)acetic acid is 41374-62-3.
※ Please kindly note that our products are for research use only.