158358-57-7 Purity
96%
If you have any other questions or need other size, please get a quote.
High activity catalyst.
4-(Methoxycarbonyl)-2-methylphenylboronic acid can effectively catalyze the homogeneous aromatic substitution reaction.
The molecular formula of the compound is C9H11BO4.
The synonyms of the compound are 158429-38-0, (4-(Methoxycarbonyl)-2-methylphenyl)boronic acid, 4-(METHOXYCARBONYL)-2-METHYLPHENYLBORONIC ACID, and [4-(methoxycarbonyl)-2-methylphenyl]boronic acid.
The molecular weight of the compound is 193.99 g/mol.
The IUPAC name of the compound is (4-methoxycarbonyl-2-methylphenyl)boronic acid.
The InChI of the compound is InChI=1S/C9H11BO4/c1-6-5-7(9(11)14-2)3-4-8(6)10(12)13/h3-5,12-13H,1-2H3.
The InChIKey of the compound is MOBGLFACQCDFEQ-UHFFFAOYSA-N.
The canonical SMILES of the compound is B(C1=C(C=C(C=C1)C(=O)OC)C)(O)O.
The CAS number of the compound is 158429-38-0.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.