What is the PubChem CID number for 4-Methoxybenzylamine?
PubChem CID 75452
What is the molecular formula of 4-Methoxybenzylamine?
The molecular formula is C8H11NO.
What are some synonyms for 4-Methoxybenzylamine?
Some synonyms include 2393-23-9, (4-Methoxyphenyl)methanamine, p-Methoxybenzylamine, and Benzenemethanamine, 4-methoxy-.
What is the molecular weight of 4-Methoxybenzylamine?
The molecular weight is 137.18 g/mol.
When was 4-Methoxybenzylamine created and modified in PubChem?
It was created on March 26, 2005, and last modified on December 30, 2023.
What is the IUPAC name of 4-Methoxybenzylamine?
The IUPAC name is (4-methoxyphenyl)methanamine.
What is the InChI of 4-Methoxybenzylamine?
The InChI is InChI=1S/C8H11NO/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6,9H2,1H3.
What is the InChIKey of 4-Methoxybenzylamine?
The InChIKey is IDPURXSQCKYKIJ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methoxybenzylamine?
The canonical SMILES is COC1=CC=C(C=C1)CN.
What is the XLogP3 value of 4-Methoxybenzylamine?
The XLogP3 value is 0.8.