4-Methoxy-3-(3-phenylpropoxy)benzaldehyde

• Catalog Number: ACMA00002749
• Category: Ethers
• Molecular Weight: 270.32
• Molecular Formula: C₁₇H₁₆O₃
• Hazard Statements: H300-H314
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C17H18O3.

What are the synonyms of the compound?

The synonyms of the compound are 4-methoxy-3-(3-phenylpropoxy)benzaldehyde, 165121-41-5, MFCD09720521, AKOS000202201, and AldrichCPR.

What is the molecular weight of the compound?

The molecular weight of the compound is 270.32 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-methoxy-3-(3-phenylpropoxy)benzaldehyde.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C17H18O3/c1-19-16-10-9-15(13-18)12-17(16)20-11-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-10,12-13H,5,8,11H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is YEQNNXTUNBZAFD-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=C(C=C(C=C1)C=O)OCCCC2=CC=CC=C2.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.6.

How many hydrogen bond donor count does the compound have?

The compound has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does the compound have?

The compound has 3 hydrogen bond acceptor count.