What is the PubChem CID of 4-Isopropoxyphenol?
The PubChem CID of 4-Isopropoxyphenol is 82001.
What is the molecular formula of 4-Isopropoxyphenol?
The molecular formula of 4-Isopropoxyphenol is C9H12O2.
What is the molecular weight of 4-Isopropoxyphenol?
The molecular weight of 4-Isopropoxyphenol is 152.19 g/mol.
What is the IUPAC name of 4-Isopropoxyphenol?
The IUPAC name of 4-Isopropoxyphenol is 4-propan-2-yloxyphenol.
What is the InChI of 4-Isopropoxyphenol?
The InChI of 4-Isopropoxyphenol is InChI=1S/C9H12O2/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7,10H,1-2H3.
What is the InChIKey of 4-Isopropoxyphenol?
The InChIKey of 4-Isopropoxyphenol is QEYQMWSESURNPP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Isopropoxyphenol?
The canonical SMILES of 4-Isopropoxyphenol is CC(C)OC1=CC=C(C=C1)O.
What is the CAS number of 4-Isopropoxyphenol?
The CAS number of 4-Isopropoxyphenol is 7495-77-4.
What is the XLogP3 value of 4-Isopropoxyphenol?
The XLogP3 value of 4-Isopropoxyphenol is 2.6.
Is 4-Isopropoxyphenol a canonicalized compound?
Yes, 4-Isopropoxyphenol is a canonicalized compound.