What is the molecular formula of 4-Isocyanobenzophenone?
The molecular formula of 4-Isocyanobenzophenone is C14H9NO.
When was 4-Isocyanobenzophenone created and modified in PubChem?
4-Isocyanobenzophenone was created on July 19, 2005, and modified on December 30, 2023.
What is the IUPAC name of 4-Isocyanobenzophenone?
The IUPAC name of 4-Isocyanobenzophenone is "(4-isocyanophenyl)-phenylmethanone."
What is the InChIKey of 4-Isocyanobenzophenone?
The InChIKey of 4-Isocyanobenzophenone is ZCMYAXFQPGJROP-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Isocyanobenzophenone?
The Canonical SMILES of 4-Isocyanobenzophenone is [C-]#[N+]C1=CC=C(C=C1)C(=O)C2=CC=CC=C2.
What is the molecular weight of 4-Isocyanobenzophenone?
The molecular weight of 4-Isocyanobenzophenone is 207.23 g/mol.
What is the XLogP3 value of 4-Isocyanobenzophenone?
The XLogP3 value of 4-Isocyanobenzophenone is 3.1.
How many hydrogen bond donor count does 4-Isocyanobenzophenone have?
4-Isocyanobenzophenone has 0 hydrogen bond donor count.
What is the topological polar surface area of 4-Isocyanobenzophenone?
The topological polar surface area of 4-Isocyanobenzophenone is 21.4 Ų.
Is 4-Isocyanobenzophenone a canonicalized compound?
Yes, 4-Isocyanobenzophenone is a canonicalized compound in PubChem.