What is the molecular formula of 4-Isobutoxy-phenylamine?
The molecular formula is C10H15NO.
What is the molecular weight of 4-Isobutoxy-phenylamine?
The molecular weight is 165.23 g/mol.
What is the IUPAC name of 4-Isobutoxy-phenylamine?
The IUPAC name is 4-(2-methylpropoxy)aniline.
What is the InChI of 4-Isobutoxy-phenylamine?
The InChI is InChI=1S/C10H15NO/c1-8(2)7-12-10-5-3-9(11)4-6-10/h3-6,8H,7,11H2,1-2H3.
What is the InChIKey of 4-Isobutoxy-phenylamine?
The InChIKey is NDHJFACYRWUMHT-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Isobutoxy-phenylamine?
The canonical SMILES is CC(C)COC1=CC=C(C=C1)N.
What is the CAS number of 4-Isobutoxy-phenylamine?
The CAS number is 5198-04-9.
What is the EC number of 4-Isobutoxy-phenylamine?
The EC number is 829-614-4.
What is the XLogP3 value of 4-Isobutoxy-phenylamine?
The XLogP3 value is 2.2.
Is 4-Isobutoxy-phenylamine a canonicalized compound?
Yes, it is a canonicalized compound.