What is the molecular formula of 4-iso-Propylcyclohexanol?
The molecular formula of 4-iso-Propylcyclohexanol is C9H18O.
What is the molecular weight of 4-iso-Propylcyclohexanol?
The molecular weight of 4-iso-Propylcyclohexanol is 142.24 g/mol.
What is the IUPAC name of 4-iso-Propylcyclohexanol?
The IUPAC name of 4-iso-Propylcyclohexanol is 4-propan-2-ylcyclohexan-1-ol.
What is the InChI of 4-iso-Propylcyclohexanol?
The InChI of 4-iso-Propylcyclohexanol is InChI=1S/C9H18O/c1-7(2)8-3-5-9(10)6-4-8/h7-10H,3-6H2,1-2H3.
What is the InChIKey of 4-iso-Propylcyclohexanol?
The InChIKey of 4-iso-Propylcyclohexanol is DKKRDMLKVSKFMJ-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-iso-Propylcyclohexanol?
The Canonical SMILES of 4-iso-Propylcyclohexanol is CC(C)C1CCC(CC1)O.
What is the CAS number of 4-iso-Propylcyclohexanol?
The CAS number of 4-iso-Propylcyclohexanol is 4621-04-9.
What is the XLogP3 value of 4-iso-Propylcyclohexanol?
The XLogP3 value of 4-iso-Propylcyclohexanol is 2.6.
What is the hydrogen bond donor count of 4-iso-Propylcyclohexanol?
The hydrogen bond donor count of 4-iso-Propylcyclohexanol is 1.
What is the hydrogen bond acceptor count of 4-iso-Propylcyclohexanol?
The hydrogen bond acceptor count of 4-iso-Propylcyclohexanol is 1.