What is the molecular formula of 4-Iodopyridin-2-amine?
The molecular formula of 4-Iodopyridin-2-amine is C5H5IN2.
What is the molecular weight of 4-Iodopyridin-2-amine?
The molecular weight of 4-Iodopyridin-2-amine is 220.01 g/mol.
What is the IUPAC name of 4-Iodopyridin-2-amine?
The IUPAC name of 4-Iodopyridin-2-amine is 4-iodopyridin-2-amine.
What is the InChI of 4-Iodopyridin-2-amine?
The InChI of 4-Iodopyridin-2-amine is InChI=1S/C5H5IN2/c6-4-1-2-8-5(7)3-4/h1-3H,(H2,7,8).
How many hydrogen bond donor counts are there in 4-Iodopyridin-2-amine?
There is 1 hydrogen bond donor count in 4-Iodopyridin-2-amine.
What is the topological polar surface area of 4-Iodopyridin-2-amine?
The topological polar surface area of 4-Iodopyridin-2-amine is 38.9 Ų.
Is 4-Iodopyridin-2-amine a canonicalized compound?
Yes, 4-Iodopyridin-2-amine is a canonicalized compound.
What is the XLogP3 value of 4-Iodopyridin-2-amine?
The XLogP3 value of 4-Iodopyridin-2-amine is 0.8.
How many defined atom stereocenters are there in 4-Iodopyridin-2-amine?
There are 0 defined atom stereocenters in 4-Iodopyridin-2-amine.
What is the CAS number of 4-Iodopyridin-2-amine?
The CAS number of 4-Iodopyridin-2-amine is 552331-00-7.