What is the molecular formula of 4-Hydroxylthiocoumarin?
The molecular formula of 4-Hydroxylthiocoumarin is C9H6O2S.
What is another name for 4-Hydroxylthiocoumarin?
Another name for 4-Hydroxylthiocoumarin is 2-hydroxythiochromen-4-one.
What is the molecular weight of 4-Hydroxylthiocoumarin?
The molecular weight of 4-Hydroxylthiocoumarin is 178.21 g/mol.
When was 4-Hydroxylthiocoumarin created?
4-Hydroxylthiocoumarin was created on July 8, 2005.
What is the IUPAC name of 4-Hydroxylthiocoumarin?
The IUPAC name of 4-Hydroxylthiocoumarin is 2-hydroxythiochromen-4-one.
What is the InChI of 4-Hydroxylthiocoumarin?
The InChI of 4-Hydroxylthiocoumarin is InChI=1S/C9H6O2S/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5,11H.
What is the InChIKey of 4-Hydroxylthiocoumarin?
The InChIKey of 4-Hydroxylthiocoumarin is OSIDMAJZERBPOJ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Hydroxylthiocoumarin?
The canonical SMILES of 4-Hydroxylthiocoumarin is C1=CC=C2C(=C1)C(=O)C=C(S2)O.
What is the CAS number of 4-Hydroxylthiocoumarin?
The CAS number of 4-Hydroxylthiocoumarin is 16854-67-4.
What is the XLogP3-AA value of 4-Hydroxylthiocoumarin?
The XLogP3-AA value of 4-Hydroxylthiocoumarin is 1.9.