What is the molecular formula of 4-Fluoro-3-(trifluoromethyl)phenylacetic acid?
The molecular formula of 4-Fluoro-3-(trifluoromethyl)phenylacetic acid is C9H6F4O2.
When was 4-Fluoro-3-(trifluoromethyl)phenylacetic acid created in PubChem?
4-Fluoro-3-(trifluoromethyl)phenylacetic acid was created in PubChem on July 19, 2005.
How can 4-Fluoro-3-(trifluoromethyl)phenylacetic acid be represented using InChI?
4-Fluoro-3-(trifluoromethyl)phenylacetic acid can be represented using the InChI: InChI=1S/C9H6F4O2/c10-7-2-1-5(4-8(14)15)3-6(7)9(11,12)13/h1-3H,4H2,(H,14,15)
What is 4-Fluoro-3-(trifluoromethyl)phenylacetic acid's canonical SMILES?
The canonical SMILES of 4-Fluoro-3-(trifluoromethyl)phenylacetic acid is C1=CC(=C(C=C1CC(=O)O)C(F)(F)F)F.
Is 4-Fluoro-3-(trifluoromethyl)phenylacetic acid designated as a Covalently-Bonded Unit in PubChem?
Yes, 4-Fluoro-3-(trifluoromethyl)phenylacetic acid is designated as a Covalently-Bonded Unit in PubChem.
What is the XLogP3-AA value for 4-Fluoro-3-(trifluoromethyl)phenylacetic acid?
The XLogP3-AA value for 4-Fluoro-3-(trifluoromethyl)phenylacetic acid is 2.4.
How many hydrogen bond acceptor counts does 4-Fluoro-3-(trifluoromethyl)phenylacetic acid have?
4-Fluoro-3-(trifluoromethyl)phenylacetic acid has 6 hydrogen bond acceptor counts.
What is the exact mass of 4-Fluoro-3-(trifluoromethyl)phenylacetic acid?
The exact mass of 4-Fluoro-3-(trifluoromethyl)phenylacetic acid is 222.03039208 g/mol.
How many rotatable bond counts does 4-Fluoro-3-(trifluoromethyl)phenylacetic acid have?
4-Fluoro-3-(trifluoromethyl)phenylacetic acid has 2 rotatable bond counts.
What is the topological polar surface area of 4-Fluoro-3-(trifluoromethyl)phenylacetic acid?
The topological polar surface area of 4-Fluoro-3-(trifluoromethyl)phenylacetic acid is 37.3 Ų.
※ Please kindly note that our products are for research use only.