What is the molecular formula of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The molecular formula of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is C10H13BFNO3.
What is the molecular weight of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The molecular weight of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is 225.03 g/mol.
What is the IUPAC name of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The IUPAC name of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is [4-fluoro-3-(propan-2-ylcarbamoyl)phenyl]boronic acid.
What is the InChI of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The InChI of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is InChI=1S/C10H13BFNO3/c1-6(2)13-10(14)8-5-7(11(15)16)3-4-9(8)12/h3-6,15-16H,1-2H3,(H,13,14).
What is the InChIKey of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The InChIKey of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is KPQHVEASBVESSL-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The canonical SMILES of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is B(C1=CC(=C(C=C1)F)C(=O)NC(C)C)(O)O.
What is the CAS number of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The CAS number of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is 874219-21-3.
What is the hydrogen bond donor count of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The hydrogen bond donor count of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is 3.
What is the hydrogen bond acceptor count of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The hydrogen bond acceptor count of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is 4.
What is the topological polar surface area of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid?
The topological polar surface area of 4-Fluoro-3-(isopropylcarbamoyl)phenylboronic acid is 69.6 Ų.
※ Please kindly note that our products are for research use only.