The molecular formula of the compound is C12H16BFO3.
What are the synonyms of the compound?
The synonyms of the compound are 1398923-95-9, 4-FLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL, 2-Fluoro-5-hydroxyphenylboronic acid, pinacol ester, MFCD16994432, and Phenol, 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl).
What is the molecular weight of the compound?
The molecular weight of the compound is 238.06 g/mol.
When was the compound created and modified?
The compound was created on March 8, 2012, and last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C12H16BFO3/c1-11(2)12(3,4)17-13(16-11)9-7-8(15)5-6-10(9)14/h5-7,15H,1-4H3.
What is the InChIKey of the compound?
The InChIKey of the compound is GXQGRXFGHPKHTH-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)O)F.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.