What is the molecular formula of 4-Ethynylbenzyl alcohol?
The molecular formula of 4-Ethynylbenzyl alcohol is C9H8O.
What is the molecular weight of 4-Ethynylbenzyl alcohol?
The molecular weight of 4-Ethynylbenzyl alcohol is 132.16 g/mol.
What is the IUPAC name of 4-Ethynylbenzyl alcohol?
The IUPAC name of 4-Ethynylbenzyl alcohol is (4-ethynylphenyl)methanol.
What is the InChI of 4-Ethynylbenzyl alcohol?
The InChI of 4-Ethynylbenzyl alcohol is InChI=1S/C9H8O/c1-2-8-3-5-9(7-10)6-4-8/h1,3-6,10H,7H2.
What is the InChIKey of 4-Ethynylbenzyl alcohol?
The InChIKey of 4-Ethynylbenzyl alcohol is QCZORVSTESPHCO-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Ethynylbenzyl alcohol?
The Canonical SMILES of 4-Ethynylbenzyl alcohol is C#CC1=CC=C(C=C1)CO.
What is the CAS number of 4-Ethynylbenzyl alcohol?
The CAS number of 4-Ethynylbenzyl alcohol is 10602-04-7.
What is the European Community (EC) number of 4-Ethynylbenzyl alcohol?
The European Community (EC) number of 4-Ethynylbenzyl alcohol is 627-942-0.
What is the DSSTox Substance ID of 4-Ethynylbenzyl alcohol?
The DSSTox Substance ID of 4-Ethynylbenzyl alcohol is DTXSID70457502.
Is 4-Ethynylbenzyl alcohol a canonicalized compound?
Yes, 4-Ethynylbenzyl alcohol is a canonicalized compound.