What is the molecular formula of 4-Ethylcyclohexanol?
The molecular formula of 4-Ethylcyclohexanol is C8H16O.
What is the molecular weight of 4-Ethylcyclohexanol?
The molecular weight of 4-Ethylcyclohexanol is 128.21 g/mol.
What is the IUPAC name of 4-Ethylcyclohexanol?
The IUPAC name of 4-Ethylcyclohexanol is 4-ethylcyclohexan-1-ol.
What is the InChI of 4-Ethylcyclohexanol?
The InChI of 4-Ethylcyclohexanol is InChI=1S/C8H16O/c1-2-7-3-5-8(9)6-4-7/h7-9H,2-6H2,1H3.
What is the InChIKey of 4-Ethylcyclohexanol?
The InChIKey of 4-Ethylcyclohexanol is RVTKUJWGFBADIN-UHFFFAOYSA-N.
What is the CAS number of 4-Ethylcyclohexanol?
The CAS number of 4-Ethylcyclohexanol is 4534-74-1.
What is the European Community (EC) number of 4-Ethylcyclohexanol?
The European Community (EC) number of 4-Ethylcyclohexanol is 224-878-1.
What is the UNII of 4-Ethylcyclohexanol?
The UNII of 4-Ethylcyclohexanol is 4WX4RJ6FFB.
What is the XLogP3 value of 4-Ethylcyclohexanol?
The XLogP3 value of 4-Ethylcyclohexanol is 2.3.
What is the hydrogen bond donor count of 4-Ethylcyclohexanol?
The hydrogen bond donor count of 4-Ethylcyclohexanol is 1.