What is the PubChem CID of 4-Ethoxyphenylacetylene?
The PubChem CID of 4-Ethoxyphenylacetylene is 2775124.
What is the molecular formula of 4-Ethoxyphenylacetylene?
The molecular formula of 4-Ethoxyphenylacetylene is C10H10O.
What are the synonyms of 4-Ethoxyphenylacetylene?
The synonyms of 4-Ethoxyphenylacetylene are 1-ethoxy-4-ethynylbenzene, 1-ethoxy-4-ethynyl-benzene, and 1-ethoxy-4-eth-1-ynylbenzene.
What is the molecular weight of 4-Ethoxyphenylacetylene?
The molecular weight of 4-Ethoxyphenylacetylene is 146.19 g/mol.
What is the IUPAC name of 4-Ethoxyphenylacetylene?
The IUPAC name of 4-Ethoxyphenylacetylene is 1-ethoxy-4-ethynylbenzene.
What is the InChI of 4-Ethoxyphenylacetylene?
The InChI of 4-Ethoxyphenylacetylene is InChI=1S/C10H10O/c1-3-9-5-7-10(8-6-9)11-4-2/h1,5-8H,4H2,2H3.
What is the InChIKey of 4-Ethoxyphenylacetylene?
The InChIKey of 4-Ethoxyphenylacetylene is FRGNOZUOTHMJSC-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Ethoxyphenylacetylene?
The canonical SMILES of 4-Ethoxyphenylacetylene is CCOC1=CC=C(C=C1)C#C.
What is the CAS number of 4-Ethoxyphenylacetylene?
The CAS number of 4-Ethoxyphenylacetylene is 79887-14-2.
Is 4-Ethoxyphenylacetylene a canonicalized compound?
Yes, 4-Ethoxyphenylacetylene is a canonicalized compound according to PubChem.