What is the molecular formula of 4-Cyanobenzyl bromide?
The molecular formula of 4-Cyanobenzyl bromide is C8H6BrN.
What is the molecular weight of 4-Cyanobenzyl bromide?
The molecular weight of 4-Cyanobenzyl bromide is 196.04 g/mol.
What is the IUPAC name of 4-Cyanobenzyl bromide?
The IUPAC name of 4-Cyanobenzyl bromide is 4-(bromomethyl)benzonitrile.
What is the InChI of 4-Cyanobenzyl bromide?
The InChI of 4-Cyanobenzyl bromide is InChI=1S/C8H6BrN/c9-5-7-1-3-8(6-10)4-2-7/h1-4H,5H2.
What is the InChIKey of 4-Cyanobenzyl bromide?
The InChIKey of 4-Cyanobenzyl bromide is UMLFTCYAQPPZER-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Cyanobenzyl bromide?
The canonical SMILES of 4-Cyanobenzyl bromide is C1=CC(=CC=C1CBr)C#N.
What is the CAS number of 4-Cyanobenzyl bromide?
The CAS number of 4-Cyanobenzyl bromide is 17201-43-3.
What is the European Community (EC) number of 4-Cyanobenzyl bromide?
The European Community (EC) number of 4-Cyanobenzyl bromide is 241-246-0.
What is the UNII of 4-Cyanobenzyl bromide?
The UNII of 4-Cyanobenzyl bromide is RV332B84ZG.
Is 4-Cyanobenzyl bromide a canonicalized compound?
Yes, 4-Cyanobenzyl bromide is a canonicalized compound.