What is the molecular formula of 4-Cyano-4-pentylbiphenyl?
The molecular formula is C18H19N.
What is the molecular weight of 4-Cyano-4-pentylbiphenyl?
The molecular weight is 249.3 g/mol.
What is the IUPAC name of 4-Cyano-4-pentylbiphenyl?
The IUPAC name is 4-(4-pentylphenyl)benzonitrile.
What is the InChI of 4-Cyano-4-pentylbiphenyl?
The InChI is InChI=1S/C18H19N/c1-2-3-4-5-15-6-10-17(11-7-15)18-12-8-16(14-19)9-13-18/h6-13H,2-5H2,1H3.
What is the InChIKey of 4-Cyano-4-pentylbiphenyl?
The InChIKey is HHPCNRKYVYWYAU-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Cyano-4-pentylbiphenyl?
The canonical SMILES is CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C#N.
What is the CAS number of 4-Cyano-4-pentylbiphenyl?
The CAS number is 40817-08-1.
What is the XLogP3 value of 4-Cyano-4-pentylbiphenyl?
The XLogP3 value is 5.4.
How many hydrogen bond donor counts does 4-Cyano-4-pentylbiphenyl have?
It has 0 hydrogen bond donor counts.
How many rotatable bond counts does 4-Cyano-4-pentylbiphenyl have?
It has 5 rotatable bond counts.