What is the molecular formula of 4-Cyano-2-methoxybenzaldehyde?
The molecular formula of 4-Cyano-2-methoxybenzaldehyde is C9H7NO2.
What is the synonyms of 4-Cyano-2-methoxybenzaldehyde?
The synonyms of 4-Cyano-2-methoxybenzaldehyde include 4-formyl-3-methoxybenzonitrile, 21962-45-8, 2-methoxy-4-cyanobenzaldehyde, and 4-Cyaon-2-methoxybenzaldehyde.
What is the molecular weight of 4-Cyano-2-methoxybenzaldehyde?
The molecular weight of 4-Cyano-2-methoxybenzaldehyde is 161.16 g/mol.
What is the IUPAC name of 4-Cyano-2-methoxybenzaldehyde?
The IUPAC name of 4-Cyano-2-methoxybenzaldehyde is 4-formyl-3-methoxybenzonitrile.
What is the InChI of 4-Cyano-2-methoxybenzaldehyde?
The InChI of 4-Cyano-2-methoxybenzaldehyde is InChI=1S/C9H7NO2/c1-12-9-4-7(5-10)2-3-8(9)6-11/h2-4,6H,1H3.
What is the InChIKey of 4-Cyano-2-methoxybenzaldehyde?
The InChIKey of 4-Cyano-2-methoxybenzaldehyde is ZXENVSJZOHXCKL-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Cyano-2-methoxybenzaldehyde?
The canonical SMILES of 4-Cyano-2-methoxybenzaldehyde is COC1=C(C=CC(=C1)C#N)C=O.
What is the CAS number of 4-Cyano-2-methoxybenzaldehyde?
The CAS number of 4-Cyano-2-methoxybenzaldehyde is 21962-45-8.
What is the European Community (EC) number of 4-Cyano-2-methoxybenzaldehyde?
The European Community (EC) number of 4-Cyano-2-methoxybenzaldehyde is 804-777-4.
What is the XLogP3 value of 4-Cyano-2-methoxybenzaldehyde?
The XLogP3 value of 4-Cyano-2-methoxybenzaldehyde is 1.3.
※ Please kindly note that our products are for research use only.